C13H21N3O2S2 — CID 80634904
1-[6-(3-methylsulfonylthiomorpholin-4-yl)-3-pyridinyl]propan-2-amine (PubChem CID 80634904) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 1-[6-(3-methylsulfonylthiomorpholin-4-yl)-3-pyridinyl]propan-2-amine.
| Compound Name | 1-[6-(3-methylsulfonylthiomorpholin-4-yl)-3-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 80634904 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1-[6-(3-methylsulfonylthiomorpholin-4-yl)-3-pyridinyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(N2CCSCC2S(C)(=O)=O)nc1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-10(14)7-11-3-4-12(15-8-11)16-5-6-19-9-13(16)20(2,17)18/h3-4,8,10,13H,5-7,9,14H2,1-2H3 |
| InChIKey | SLZTXEZQOBJYTL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |