C13H22N4O2S2 — CID 66383798
N-[[6-(3-methylsulfonylthiomorpholin-4-yl)pyridazin-3-yl]methyl]propan-2-amine (PubChem CID 66383798) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[[6-(3-methylsulfonylthiomorpholin-4-yl)pyridazin-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[6-(3-methylsulfonylthiomorpholin-4-yl)pyridazin-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66383798 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[[6-(3-methylsulfonylthiomorpholin-4-yl)pyridazin-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(N2CCSCC2S(C)(=O)=O)nn1 |
| InChI | InChI=1S/C13H22N4O2S2/c1-10(2)14-8-11-4-5-12(16-15-11)17-6-7-20-9-13(17)21(3,18)19/h4-5,10,13-14H,6-9H2,1-3H3 |
| InChIKey | CGGHEYAPFWZGIB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |