C13H16N4O2S2 — CID 66382775
4-(3-methylsulfonylthiomorpholin-4-yl)quinazolin-6-amine (PubChem CID 66382775) has the molecular formula C13H16N4O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-(3-methylsulfonylthiomorpholin-4-yl)quinazolin-6-amine.
| Compound Name | 4-(3-methylsulfonylthiomorpholin-4-yl)quinazolin-6-amine |
|---|---|
| PubChem CID | 66382775 |
| Molecular Formula | C13H16N4O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(3-methylsulfonylthiomorpholin-4-yl)quinazolin-6-amine |
| SMILES | CS(=O)(=O)C1CSCCN1c1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C13H16N4O2S2/c1-21(18,19)12-7-20-5-4-17(12)13-10-6-9(14)2-3-11(10)15-8-16-13/h2-3,6,8,12H,4-5,7,14H2,1H3 |
| InChIKey | NJQGCDAOLOAZJD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|