C12H15N3O2S3 — CID 66382584
2-(3-methylsulfonylthiomorpholin-4-yl)-1,3-benzothiazol-6-amine (PubChem CID 66382584) has the molecular formula C12H15N3O2S3 and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-(3-methylsulfonylthiomorpholin-4-yl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(3-methylsulfonylthiomorpholin-4-yl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 66382584 |
| Molecular Formula | C12H15N3O2S3 |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-(3-methylsulfonylthiomorpholin-4-yl)-1,3-benzothiazol-6-amine |
| SMILES | CS(=O)(=O)C1CSCCN1c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C12H15N3O2S3/c1-20(16,17)11-7-18-5-4-15(11)12-14-9-3-2-8(13)6-10(9)19-12/h2-3,6,11H,4-5,7,13H2,1H3 |
| InChIKey | LXRLWTGOWSOBEN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|