C12H15N3O2S2 — CID 66382393
5-amino-2-(3-methylsulfonylthiomorpholin-4-yl)benzonitrile (PubChem CID 66382393) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 5-amino-2-(3-methylsulfonylthiomorpholin-4-yl)benzonitrile.
| Compound Name | 5-amino-2-(3-methylsulfonylthiomorpholin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 66382393 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 5-amino-2-(3-methylsulfonylthiomorpholin-4-yl)benzonitrile |
| SMILES | CS(=O)(=O)C1CSCCN1c1ccc(N)cc1C#N |
| InChI | InChI=1S/C12H15N3O2S2/c1-19(16,17)12-8-18-5-4-15(12)11-3-2-10(14)6-9(11)7-13/h2-3,6,12H,4-5,8,14H2,1H3 |
| InChIKey | BWUNYLGIVXMPCJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|