C8H13F2NO2S — CID 66445733
2-[4-(2,2-difluoroethyl)thiomorpholin-3-yl]acetic acid (PubChem CID 66445733) has the molecular formula C8H13F2NO2S and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethyl)thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-(2,2-difluoroethyl)thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66445733 |
| Molecular Formula | C8H13F2NO2S |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-[4-(2,2-difluoroethyl)thiomorpholin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CSCCN1CC(F)F |
| InChI | InChI=1S/C8H13F2NO2S/c9-7(10)4-11-1-2-14-5-6(11)3-8(12)13/h6-7H,1-5H2,(H,12,13) |
| InChIKey | GJKRNDUXXONZHF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |