C17H20ClN3OS — CID 111495416
N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide (PubChem CID 111495416) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 111495416 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N'-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H20ClN3OS/c1-2-19-17(20-11-14(22)15-7-8-16(18)23-15)21-10-9-12-5-3-4-6-13(12)21/h3-8,14,22H,2,9-11H2,1H3,(H,19,20) |
| InChIKey | WZMZPRZAUWEBIR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|