C19H23ClIN3O — CID 110984421
N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110984421) has the molecular formula C19H23ClIN3O and a molecular weight of 471.77 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110984421 |
| Molecular Formula | C19H23ClIN3O |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | N'-[2-(4-chlorophenyl)-2-hydroxyethyl]-N-ethyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C19H22ClN3O.HI/c1-2-21-19(23-12-11-14-5-3-4-6-17(14)23)22-13-18(24)15-7-9-16(20)10-8-15;/h3-10,18,24H,2,11-13H2,1H3,(H,21,22);1H |
| InChIKey | VJZQZTOREICNTG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|