C21H34N6O3 — CID 111366603
N-[2-[[ethylamino-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]methylidene]amino]ethyl]-2-hydroxybenzamide (PubChem CID 111366603) has the molecular formula C21H34N6O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[2-[[ethylamino-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]methylidene]amino]ethyl]-2-hydroxybenzamide.
| Compound Name | N-[2-[[ethylamino-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]methylidene]amino]ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 111366603 |
| Molecular Formula | C21H34N6O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | N-[2-[[ethylamino-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]methylidene]amino]ethyl]-2-hydroxybenzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccccc1O)N1CCN(CC(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C21H34N6O3/c1-4-22-21(24-10-9-23-20(30)17-7-5-6-8-18(17)28)27-13-11-26(12-14-27)15-19(29)25-16(2)3/h5-8,16,28H,4,9-15H2,1-3H3,(H,22,24)(H,23,30)(H,25,29) |
| InChIKey | UTMAKQIIBCAEOV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|