C17H29ClN4OS — CID 111501849
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111501849) has the molecular formula C17H29ClN4OS and a molecular weight of 372.97 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111501849 |
| Molecular Formula | C17H29ClN4OS |
| Molecular Weight | 372.97 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/CC(O)c2ccc(Cl)s2)NCC)CC1 |
| InChI | InChI=1S/C17H29ClN4OS/c1-3-9-22-10-7-13(8-11-22)21-17(19-4-2)20-12-14(23)15-5-6-16(18)24-15/h5-6,13-14,23H,3-4,7-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | OPNPNELZJLTRJI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.97 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|