C17H30ClIN4OS — CID 111702018
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methylpiperidin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111702018) has the molecular formula C17H30ClIN4OS and a molecular weight of 500.88 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methylpiperidin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methylpiperidin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111702018 |
| Molecular Formula | C17H30ClIN4OS |
| Molecular Weight | 500.88 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[2-(2-methylpiperidin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCCN1CCCCC1C.I |
| InChI | InChI=1S/C17H29ClN4OS.HI/c1-3-19-17(20-9-11-22-10-5-4-6-13(22)2)21-12-14(23)15-7-8-16(18)24-15;/h7-8,13-14,23H,3-6,9-12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | ZUCUZRDVQSKCRO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|