C16H27ClN4OS — CID 111702296
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[(1-ethylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 111702296) has the molecular formula C16H27ClN4OS and a molecular weight of 358.94 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[(1-ethylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[(1-ethylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111702296 |
| Molecular Formula | C16H27ClN4OS |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-1-ethyl-3-[(1-ethylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)NCC1CCN(CC)C1 |
| InChI | InChI=1S/C16H27ClN4OS/c1-3-18-16(19-9-12-7-8-21(4-2)11-12)20-10-13(22)14-5-6-15(17)23-14/h5-6,12-13,22H,3-4,7-11H2,1-2H3,(H2,18,19,20) |
| InChIKey | XNTSCFAWBNBXDG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|