C17H29IN4 — CID 110961404
N-ethyl-N'-(2-methylpropyl)-4-phenylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110961404) has the molecular formula C17H29IN4 and a molecular weight of 416.35 g/mol. Its IUPAC name is N-ethyl-N'-(2-methylpropyl)-4-phenylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-methylpropyl)-4-phenylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110961404 |
| Molecular Formula | C17H29IN4 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-ethyl-N'-(2-methylpropyl)-4-phenylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C17H28N4.HI/c1-4-18-17(19-14-15(2)3)21-12-10-20(11-13-21)16-8-6-5-7-9-16;/h5-9,15H,4,10-14H2,1-3H3,(H,18,19);1H |
| InChIKey | HQNVBLWGRMXEGA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|