C18H25ClIN3O2S — CID 111502270
2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111502270) has the molecular formula C18H25ClIN3O2S and a molecular weight of 509.84 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111502270 |
| Molecular Formula | C18H25ClIN3O2S |
| Molecular Weight | 509.84 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-2-hydroxyethyl]-3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)s1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C18H24ClN3O2S.HI/c1-4-20-18(21-11-14(23)16-9-10-17(19)25-16)22(2)12-13-7-5-6-8-15(13)24-3;/h5-10,14,23H,4,11-12H2,1-3H3,(H,20,21);1H |
| InChIKey | IQPALFACKFWCJR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|