C20H29IN6O — CID 111414642
N,N-dimethyl-2-[[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111414642) has the molecular formula C20H29IN6O and a molecular weight of 496.40 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111414642 |
| Molecular Formula | C20H29IN6O |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]-(2-methylprop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)N(C)Cc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C20H28N6O.HI/c1-16(2)11-21-20(22-13-19(27)24(3)4)25(5)14-17-12-23-26(15-17)18-9-7-6-8-10-18;/h6-10,12,15H,1,11,13-14H2,2-5H3,(H,21,22);1H |
| InChIKey | YATREFBCLBERDH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|