C19H30N6 — CID 111995497
1-(4,4-dimethylcyclohexyl)-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111995497) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111995497 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-3-ethyl-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)NC1CCC(C)(C)CC1 |
| InChI | InChI=1S/C19H30N6/c1-4-20-18(22-15-8-11-19(2,3)12-9-15)21-13-10-17-24-23-16-7-5-6-14-25(16)17/h5-7,14-15H,4,8-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | KZKNWJUZIHRCAH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|