C24H34IN7 — CID 111994198
1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111994198) has the molecular formula C24H34IN7 and a molecular weight of 547.49 g/mol. Its IUPAC name is 1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994198 |
| Molecular Formula | C24H34IN7 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 1-ethyl-3-[1-(1-phenylethyl)piperidin-4-yl]-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)NC1CCN(C(C)c2ccccc2)CC1.I |
| InChI | InChI=1S/C24H33N7.HI/c1-3-25-24(26-15-12-23-29-28-22-11-7-8-16-31(22)23)27-21-13-17-30(18-14-21)19(2)20-9-5-4-6-10-20;/h4-11,16,19,21H,3,12-15,17-18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | IJDGXQXQNBYHJM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|