C16H24N6S — CID 111997825
1-ethyl-3-(thian-3-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111997825) has the molecular formula C16H24N6S and a molecular weight of 332.48 g/mol. Its IUPAC name is 1-ethyl-3-(thian-3-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-(thian-3-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111997825 |
| Molecular Formula | C16H24N6S |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-ethyl-3-(thian-3-yl)-2-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nnc2ccccn12)NC1CCCSC1 |
| InChI | InChI=1S/C16H24N6S/c1-2-17-16(19-13-6-5-11-23-12-13)18-9-8-15-21-20-14-7-3-4-10-22(14)15/h3-4,7,10,13H,2,5-6,8-9,11-12H2,1H3,(H2,17,18,19) |
| InChIKey | VBERCEHMBQTCCT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|