C16H24N4O2 — CID 111975104
1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2,3-dimethylguanidine (PubChem CID 111975104) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2,3-dimethylguanidine.
| Compound Name | 1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 111975104 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCCCc1cc2c(OC)cc(OC)cc2[nH]1 |
| InChI | InChI=1S/C16H24N4O2/c1-17-16(18-2)19-7-5-6-11-8-13-14(20-11)9-12(21-3)10-15(13)22-4/h8-10,20H,5-7H2,1-4H3,(H2,17,18,19) |
| InChIKey | CRCVYEGXHRFPQW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|