C18H27IN4O2 — CID 111975568
1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111975568) has the molecular formula C18H27IN4O2 and a molecular weight of 458.34 g/mol. Its IUPAC name is 1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111975568 |
| Molecular Formula | C18H27IN4O2 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NCCCc1cc2c(OC)cc(OC)cc2[nH]1.I |
| InChI | InChI=1S/C18H26N4O2.HI/c1-12(2)11-21-18(19)20-7-5-6-13-8-15-16(22-13)9-14(23-3)10-17(15)24-4;/h8-10,22H,1,5-7,11H2,2-4H3,(H3,19,20,21);1H |
| InChIKey | BQUHQLCPJWDJCD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|