C18H27N3O3 — CID 120564052
4-amino-N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]pentanamide (PubChem CID 120564052) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-amino-N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]pentanamide.
| Compound Name | 4-amino-N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 120564052 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 4-amino-N-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]pentanamide |
| SMILES | COc1cc(OC)c2cc(CCCNC(=O)CCC(C)N)[nH]c2c1 |
| InChI | InChI=1S/C18H27N3O3/c1-12(19)6-7-18(22)20-8-4-5-13-9-15-16(21-13)10-14(23-2)11-17(15)24-3/h9-12,21H,4-8,19H2,1-3H3,(H,20,22) |
| InChIKey | OSJYBBBUWKAAFV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|