C23H36IN5O4 — CID 111975546
tert-butyl 4-[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111975546) has the molecular formula C23H36IN5O4 and a molecular weight of 573.48 g/mol. Its IUPAC name is tert-butyl 4-[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111975546 |
| Molecular Formula | C23H36IN5O4 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | tert-butyl 4-[N'-[3-(4,6-dimethoxy-1H-indol-2-yl)propyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | COc1cc(OC)c2cc(CCC/N=C(\N)N3CCN(C(=O)OC(C)(C)C)CC3)[nH]c2c1.I |
| InChI | InChI=1S/C23H35N5O4.HI/c1-23(2,3)32-22(29)28-11-9-27(10-12-28)21(24)25-8-6-7-16-13-18-19(26-16)14-17(30-4)15-20(18)31-5;/h13-15,26H,6-12H2,1-5H3,(H2,24,25);1H |
| InChIKey | RWKRATDTMJWTQK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|