C18H29N3O3S — CID 109487913
N',2,2-trimethyl-N-[(2,4,5-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109487913) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[(2,4,5-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[(2,4,5-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109487913 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N',2,2-trimethyl-N-[(2,4,5-trimethoxyphenyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)cc1OC)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C18H29N3O3S/c1-18(2)12-21(7-8-25-18)17(19-3)20-11-13-9-15(23-5)16(24-6)10-14(13)22-4/h9-10H,7-8,11-12H2,1-6H3,(H,19,20) |
| InChIKey | IEEWCLOMAXENJR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|