C17H25F2N3O2S — CID 109489541
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide (PubChem CID 109489541) has the molecular formula C17H25F2N3O2S and a molecular weight of 373.47 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489541 |
| Molecular Formula | C17H25F2N3O2S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N',2,2-trimethylthiomorpholine-4-carboximidamide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC(F)F)c1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H25F2N3O2S/c1-17(2)11-22(7-8-25-17)16(20-3)21-10-12-5-6-13(23-4)14(9-12)24-15(18)19/h5-6,9,15H,7-8,10-11H2,1-4H3,(H,20,21) |
| InChIKey | GJNJBXLZPWQYHM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|