C18H30IN5O3 — CID 111055700
4-methoxy-N-[2-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111055700) has the molecular formula C18H30IN5O3 and a molecular weight of 491.37 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 4-methoxy-N-[2-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111055700 |
| Molecular Formula | C18H30IN5O3 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-methoxy-N-[2-[[N'-(3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | COc1ccc(C(=O)NCCN/C(N)=N/CCCN2CCOCC2)cc1.I |
| InChI | InChI=1S/C18H29N5O3.HI/c1-25-16-5-3-15(4-6-16)17(24)20-8-9-22-18(19)21-7-2-10-23-11-13-26-14-12-23;/h3-6H,2,7-14H2,1H3,(H,20,24)(H3,19,21,22);1H |
| InChIKey | ACTSKTXBLZUTQU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|