C16H29N5O5 — CID 3849029
N-(2-methoxyethyl)-N'-[[4-(3-morpholin-4-ylpropylamino)-4-oxobutan-2-ylidene]amino]oxamide (PubChem CID 3849029) has the molecular formula C16H29N5O5 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-[[4-(3-morpholin-4-ylpropylamino)-4-oxobutan-2-ylidene]amino]oxamide.
| Compound Name | N-(2-methoxyethyl)-N'-[[4-(3-morpholin-4-ylpropylamino)-4-oxobutan-2-ylidene]amino]oxamide |
|---|---|
| PubChem CID | 3849029 |
| Molecular Formula | C16H29N5O5 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-(2-methoxyethyl)-N'-[[4-(3-morpholin-4-ylpropylamino)-4-oxobutan-2-ylidene]amino]oxamide |
| SMILES | COCCNC(=O)C(=O)NN=C(C)CC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C16H29N5O5/c1-13(19-20-16(24)15(23)18-5-9-25-2)12-14(22)17-4-3-6-21-7-10-26-11-8-21/h3-12H2,1-2H3,(H,17,22)(H,18,23)(H,20,24) |
| InChIKey | LKGZUEFLTZNFRE-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|