C17H35N3O2 — CID 119642279
N-(2-amino-2-ethylbutyl)-3-ethyl-2-morpholin-4-ylpentanamide (PubChem CID 119642279) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-ethyl-2-morpholin-4-ylpentanamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-ethyl-2-morpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 119642279 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-ethyl-2-morpholin-4-ylpentanamide |
| SMILES | CCC(CC)C(C(=O)NCC(N)(CC)CC)N1CCOCC1 |
| InChI | InChI=1S/C17H35N3O2/c1-5-14(6-2)15(20-9-11-22-12-10-20)16(21)19-13-17(18,7-3)8-4/h14-15H,5-13,18H2,1-4H3,(H,19,21) |
| InChIKey | CUEOQBASKDPHQJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |