C19H33N3O2 — CID 119035606
3-ethyl-2-morpholin-4-yl-N-[(1-propylpyrrol-3-yl)methyl]pentanamide (PubChem CID 119035606) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 3-ethyl-2-morpholin-4-yl-N-[(1-propylpyrrol-3-yl)methyl]pentanamide.
| Compound Name | 3-ethyl-2-morpholin-4-yl-N-[(1-propylpyrrol-3-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 119035606 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 3-ethyl-2-morpholin-4-yl-N-[(1-propylpyrrol-3-yl)methyl]pentanamide |
| SMILES | CCCn1ccc(CNC(=O)C(C(CC)CC)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H33N3O2/c1-4-8-21-9-7-16(15-21)14-20-19(23)18(17(5-2)6-3)22-10-12-24-13-11-22/h7,9,15,17-18H,4-6,8,10-14H2,1-3H3,(H,20,23) |
| InChIKey | WQZRGZKXDSGLQA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |