C13H21N3O2 — CID 55241149
5-(cycloheptylamino)-1,3-dimethylpyrazole-4-carboxylic acid (PubChem CID 55241149) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(cycloheptylamino)-1,3-dimethylpyrazole-4-carboxylic acid.
| Compound Name | 5-(cycloheptylamino)-1,3-dimethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 55241149 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 5-(cycloheptylamino)-1,3-dimethylpyrazole-4-carboxylic acid |
| SMILES | Cc1nn(C)c(NC2CCCCCC2)c1C(=O)O |
| InChI | InChI=1S/C13H21N3O2/c1-9-11(13(17)18)12(16(2)15-9)14-10-7-5-3-4-6-8-10/h10,14H,3-8H2,1-2H3,(H,17,18) |
| InChIKey | FPGBPDHACIXPTJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |