C14H23N5S — CID 63756883
5-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63756883) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-dimethylpyrazole-4-carbothioamide.
| Compound Name | 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-dimethylpyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63756883 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 5-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(NC2CCN3CCCCC23)c1C(N)=S |
| InChI | InChI=1S/C14H23N5S/c1-9-12(13(15)20)14(18(2)17-9)16-10-6-8-19-7-4-3-5-11(10)19/h10-11,16H,3-8H2,1-2H3,(H2,15,20) |
| InChIKey | KZGVUTGGLMREGE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|