C14H24N4O2S — CID 80511343
5,6-diethyl-3-[2-(2-methoxyethoxy)ethylamino]pyridazine-4-carbothioamide (PubChem CID 80511343) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 5,6-diethyl-3-[2-(2-methoxyethoxy)ethylamino]pyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-[2-(2-methoxyethoxy)ethylamino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80511343 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5,6-diethyl-3-[2-(2-methoxyethoxy)ethylamino]pyridazine-4-carbothioamide |
| SMILES | CCc1nnc(NCCOCCOC)c(C(N)=S)c1CC |
| InChI | InChI=1S/C14H24N4O2S/c1-4-10-11(5-2)17-18-14(12(10)13(15)21)16-6-7-20-9-8-19-3/h4-9H2,1-3H3,(H2,15,21)(H,16,18) |
| InChIKey | ROPSPGNITZHRQS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|