About 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide
3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 61098457) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide.
Molecular Properties
| Compound Name | 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide |
| PubChem CID | 61098457 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | CCOCCNc1nnc(C)c(C)c1C(N)=S |
| InChI | InChI=1S/C11H18N4OS/c1-4-16-6-5-13-11-9(10(12)17)7(2)8(3)14-15-11/h4-6H2,1-3H3,(H2,12,17)(H,13,15) |
| InChIKey | JVNHCYYYKNXSTK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide?
The IUPAC name of 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide (CID 61098457) is 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide.
What is the SMILES notation for 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide?
The canonical SMILES for 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide is CCOCCNc1nnc(C)c(C)c1C(N)=S.
What is the InChIKey of 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide?
The InChIKey is JVNHCYYYKNXSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c1-4-16-6-5-13-11-9(10(12)17)7(2)8(3)14-15-11/h4-6H2,1-3H3,(H2,12,17)(H,13,15).
What are the key properties of 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide?
3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide has a molecular weight of 254.36 g/mol, XLogP of 1.18, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethoxyethylamino)-5,6-dimethylpyridazine-4-carbothioamide is sourced from PubChem (CID 61098457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).