C12H19N5OS — CID 106277533
3-[(4-carbamothioyl-5,6-dimethylpyridazin-3-yl)amino]-2,2-dimethylpropanamide (PubChem CID 106277533) has the molecular formula C12H19N5OS and a molecular weight of 281.39 g/mol. Its IUPAC name is 3-[(4-carbamothioyl-5,6-dimethylpyridazin-3-yl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(4-carbamothioyl-5,6-dimethylpyridazin-3-yl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106277533 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[(4-carbamothioyl-5,6-dimethylpyridazin-3-yl)amino]-2,2-dimethylpropanamide |
| SMILES | Cc1nnc(NCC(C)(C)C(N)=O)c(C(N)=S)c1C |
| InChI | InChI=1S/C12H19N5OS/c1-6-7(2)16-17-10(8(6)9(13)19)15-5-12(3,4)11(14)18/h5H2,1-4H3,(H2,13,19)(H2,14,18)(H,15,17) |
| InChIKey | NHUABYSORSKKJI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|