C11H13N5S2 — CID 63825719
5,6-dimethyl-3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carbothioamide (PubChem CID 63825719) has the molecular formula C11H13N5S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 5,6-dimethyl-3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carbothioamide.
| Compound Name | 5,6-dimethyl-3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 63825719 |
| Molecular Formula | C11H13N5S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5,6-dimethyl-3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carbothioamide |
| SMILES | Cc1nnc(NCc2cscn2)c(C(N)=S)c1C |
| InChI | InChI=1S/C11H13N5S2/c1-6-7(2)15-16-11(9(6)10(12)17)13-3-8-4-18-5-14-8/h4-5H,3H2,1-2H3,(H2,12,17)(H,13,16) |
| InChIKey | IRNPCOKDRVAYOS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|