About 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide
3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide (PubChem CID 114167405) has the molecular formula C12H18N4OS
and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide |
| PubChem CID | 114167405 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(C(N)=S)c(NCC(C)(C)C(N)=O)n1 |
| InChI | InChI=1S/C12H18N4OS/c1-7-4-5-8(9(13)18)10(16-7)15-6-12(2,3)11(14)17/h4-5H,6H2,1-3H3,(H2,13,18)(H2,14,17)(H,15,16) |
| InChIKey | VZKLQPYQUAAZIW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide?
The IUPAC name of 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide (CID 114167405) is 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide.
What is the SMILES notation for 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide?
The canonical SMILES for 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide is Cc1ccc(C(N)=S)c(NCC(C)(C)C(N)=O)n1.
What is the InChIKey of 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide?
The InChIKey is VZKLQPYQUAAZIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS/c1-7-4-5-8(9(13)18)10(16-7)15-6-12(2,3)11(14)17/h4-5H,6H2,1-3H3,(H2,13,18)(H2,14,17)(H,15,16).
What are the key properties of 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide?
3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide has a molecular weight of 266.37 g/mol, XLogP of 0.95, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-carbamothioyl-6-methyl-2-pyridinyl)amino]-2,2-dimethylpropanamide is sourced from PubChem (CID 114167405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).