C11H13N5OS — CID 106399820
6-methyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]pyridine-3-carbothioamide (PubChem CID 106399820) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 6-methyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]pyridine-3-carbothioamide.
| Compound Name | 6-methyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 106399820 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 6-methyl-2-[2-(1,2,4-oxadiazol-3-yl)ethylamino]pyridine-3-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(NCCc2ncon2)n1 |
| InChI | InChI=1S/C11H13N5OS/c1-7-2-3-8(10(12)18)11(15-7)13-5-4-9-14-6-17-16-9/h2-3,6H,4-5H2,1H3,(H2,12,18)(H,13,15) |
| InChIKey | JRMTUZMXAFETPT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|