C12H19N3OS — CID 80512775
5,6-diethyl-3-propoxypyridazine-4-carbothioamide (PubChem CID 80512775) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 5,6-diethyl-3-propoxypyridazine-4-carbothioamide.
| Compound Name | 5,6-diethyl-3-propoxypyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80512775 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 5,6-diethyl-3-propoxypyridazine-4-carbothioamide |
| SMILES | CCCOc1nnc(CC)c(CC)c1C(N)=S |
| InChI | InChI=1S/C12H19N3OS/c1-4-7-16-12-10(11(13)17)8(5-2)9(6-3)14-15-12/h4-7H2,1-3H3,(H2,13,17) |
| InChIKey | IJESDTVOCJUQEI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|