C13H14N4S — CID 61175375
4,6-dimethyl-2-(pyridin-3-ylamino)pyridine-3-carbothioamide (PubChem CID 61175375) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 4,6-dimethyl-2-(pyridin-3-ylamino)pyridine-3-carbothioamide.
| Compound Name | 4,6-dimethyl-2-(pyridin-3-ylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61175375 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4,6-dimethyl-2-(pyridin-3-ylamino)pyridine-3-carbothioamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(Nc2cccnc2)n1 |
| InChI | InChI=1S/C13H14N4S/c1-8-6-9(2)16-13(11(8)12(14)18)17-10-4-3-5-15-7-10/h3-7H,1-2H3,(H2,14,18)(H,16,17) |
| InChIKey | MTUSVMBGPQZGOG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|