C14H12ClF2N3S — CID 83074706
2-(2-chloro-4,6-difluoroanilino)-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 83074706) has the molecular formula C14H12ClF2N3S and a molecular weight of 327.79 g/mol. Its IUPAC name is 2-(2-chloro-4,6-difluoroanilino)-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-(2-chloro-4,6-difluoroanilino)-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 83074706 |
| Molecular Formula | C14H12ClF2N3S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-(2-chloro-4,6-difluoroanilino)-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(Nc2c(F)cc(F)cc2Cl)n1 |
| InChI | InChI=1S/C14H12ClF2N3S/c1-6-3-7(2)19-14(11(6)13(18)21)20-12-9(15)4-8(16)5-10(12)17/h3-5H,1-2H3,(H2,18,21)(H,19,20) |
| InChIKey | YDLQFLRWFIWMQK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|