C15H16ClN3OS — CID 107621979
2-(4-chloro-3-methoxyanilino)-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 107621979) has the molecular formula C15H16ClN3OS and a molecular weight of 321.83 g/mol. Its IUPAC name is 2-(4-chloro-3-methoxyanilino)-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-(4-chloro-3-methoxyanilino)-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 107621979 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-(4-chloro-3-methoxyanilino)-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | COc1cc(Nc2nc(C)cc(C)c2C(N)=S)ccc1Cl |
| InChI | InChI=1S/C15H16ClN3OS/c1-8-6-9(2)18-15(13(8)14(17)21)19-10-4-5-11(16)12(7-10)20-3/h4-7H,1-3H3,(H2,17,21)(H,18,19) |
| InChIKey | CZICBDWVPMETSY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|