C15H16BrN3S — CID 63519800
2-(3-bromo-4-methylanilino)-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 63519800) has the molecular formula C15H16BrN3S and a molecular weight of 350.29 g/mol. Its IUPAC name is 2-(3-bromo-4-methylanilino)-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-(3-bromo-4-methylanilino)-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 63519800 |
| Molecular Formula | C15H16BrN3S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-(3-bromo-4-methylanilino)-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(Nc2ccc(C)c(Br)c2)n1 |
| InChI | InChI=1S/C15H16BrN3S/c1-8-4-5-11(7-12(8)16)19-15-13(14(17)20)9(2)6-10(3)18-15/h4-7H,1-3H3,(H2,17,20)(H,18,19) |
| InChIKey | WFEUYVAMALFKFY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|