C13H20N4OS — CID 106096792
3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-3-methylbutanamide (PubChem CID 106096792) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-3-methylbutanamide.
| Compound Name | 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106096792 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]-3-methylbutanamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(NC(C)(C)CC(N)=O)n1 |
| InChI | InChI=1S/C13H20N4OS/c1-7-5-8(2)16-12(10(7)11(15)19)17-13(3,4)6-9(14)18/h5H,6H2,1-4H3,(H2,14,18)(H2,15,19)(H,16,17) |
| InChIKey | HUTGKMORMPRDEN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|