C11H18N4O2S2 — CID 61176710
2-[2-(methanesulfonamido)ethylamino]-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 61176710) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)ethylamino]-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-[2-(methanesulfonamido)ethylamino]-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61176710 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[2-(methanesulfonamido)ethylamino]-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(C)c(C(N)=S)c(NCCNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H18N4O2S2/c1-7-6-8(2)15-11(9(7)10(12)18)13-4-5-14-19(3,16)17/h6,14H,4-5H2,1-3H3,(H2,12,18)(H,13,15) |
| InChIKey | BZBKRRUUOGQHCB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|