C12H17N3O2S — CID 61295387
methyl 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]propanoate (PubChem CID 61295387) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is methyl 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 61295387 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | methyl 3-[(3-carbamothioyl-4,6-dimethyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)CCNc1nc(C)cc(C)c1C(N)=S |
| InChI | InChI=1S/C12H17N3O2S/c1-7-6-8(2)15-12(10(7)11(13)18)14-5-4-9(16)17-3/h6H,4-5H2,1-3H3,(H2,13,18)(H,14,15) |
| InChIKey | BDJDRNYTQCZJEN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|