C15H15ClN2O2S — CID 63086601
3-chloro-4-(3,4-dimethoxyanilino)benzenecarbothioamide (PubChem CID 63086601) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyanilino)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(3,4-dimethoxyanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63086601 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyanilino)benzenecarbothioamide |
| SMILES | COc1ccc(Nc2ccc(C(N)=S)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H15ClN2O2S/c1-19-13-6-4-10(8-14(13)20-2)18-12-5-3-9(15(17)21)7-11(12)16/h3-8,18H,1-2H3,(H2,17,21) |
| InChIKey | HRZKRMCVRUYTSD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|