C13H9ClF2N2S — CID 63087780
3-chloro-4-(3,4-difluoroanilino)benzenecarbothioamide (PubChem CID 63087780) has the molecular formula C13H9ClF2N2S and a molecular weight of 298.75 g/mol. Its IUPAC name is 3-chloro-4-(3,4-difluoroanilino)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(3,4-difluoroanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63087780 |
| Molecular Formula | C13H9ClF2N2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 3-chloro-4-(3,4-difluoroanilino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Nc2ccc(F)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C13H9ClF2N2S/c14-9-5-7(13(17)19)1-4-12(9)18-8-2-3-10(15)11(16)6-8/h1-6,18H,(H2,17,19) |
| InChIKey | MXELBXTWWZJHRB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|