C14H16N4S — CID 81053983
2,6-dimethyl-4-(pyridin-3-ylmethylamino)pyridine-3-carbothioamide (PubChem CID 81053983) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 2,6-dimethyl-4-(pyridin-3-ylmethylamino)pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-(pyridin-3-ylmethylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81053983 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,6-dimethyl-4-(pyridin-3-ylmethylamino)pyridine-3-carbothioamide |
| SMILES | Cc1cc(NCc2cccnc2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H16N4S/c1-9-6-12(13(14(15)19)10(2)18-9)17-8-11-4-3-5-16-7-11/h3-7H,8H2,1-2H3,(H2,15,19)(H,17,18) |
| InChIKey | VNGBJVNOWDBLRL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|