C10H15N3S — CID 81060050
4-(ethylamino)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81060050) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 4-(ethylamino)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(ethylamino)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81060050 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-(ethylamino)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | CCNc1cc(C)nc(C)c1C(N)=S |
| InChI | InChI=1S/C10H15N3S/c1-4-12-8-5-6(2)13-7(3)9(8)10(11)14/h5H,4H2,1-3H3,(H2,11,14)(H,12,13) |
| InChIKey | FQAYBBWNOATDDT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|