C16H27N3S — CID 115568255
2,6-dimethyl-4-(octylamino)pyridine-3-carbothioamide (PubChem CID 115568255) has the molecular formula C16H27N3S and a molecular weight of 293.48 g/mol. Its IUPAC name is 2,6-dimethyl-4-(octylamino)pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-(octylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 115568255 |
| Molecular Formula | C16H27N3S |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2,6-dimethyl-4-(octylamino)pyridine-3-carbothioamide |
| SMILES | CCCCCCCCNc1cc(C)nc(C)c1C(N)=S |
| InChI | InChI=1S/C16H27N3S/c1-4-5-6-7-8-9-10-18-14-11-12(2)19-13(3)15(14)16(17)20/h11H,4-10H2,1-3H3,(H2,17,20)(H,18,19) |
| InChIKey | DLPYOTXQVCSFKD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|