C14H23N3S — CID 81054632
4-(2,3-dimethylbutylamino)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81054632) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 4-(2,3-dimethylbutylamino)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(2,3-dimethylbutylamino)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81054632 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-(2,3-dimethylbutylamino)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(NCC(C)C(C)C)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C14H23N3S/c1-8(2)9(3)7-16-12-6-10(4)17-11(5)13(12)14(15)18/h6,8-9H,7H2,1-5H3,(H2,15,18)(H,16,17) |
| InChIKey | IVEYAFIAYWYFLB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|